C26H31NO3 — CID 54553080
benzyl (2S)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate (PubChem CID 54553080) has the molecular formula C26H31NO3 and a molecular weight of 405.54 g/mol. Its IUPAC name is benzyl (2S)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate.
| Compound Name | benzyl (2S)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate |
|---|---|
| PubChem CID | 54553080 |
| Molecular Formula | C26H31NO3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | benzyl (2S)-4-[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-benzyl-4-oxobutanoate |
| SMILES | O=C(OCc1ccccc1)[C@H](CC(=O)N1C[C@H]2CCCC[C@H]2C1)Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO3/c28-25(27-17-22-13-7-8-14-23(22)18-27)16-24(15-20-9-3-1-4-10-20)26(29)30-19-21-11-5-2-6-12-21/h1-6,9-12,22-24H,7-8,13-19H2/t22-,23+,24-/m0/s1 |
| InChIKey | ZLGJAPPHSNWLBJ-VXNXHJTFSA-N |
| XLogP | 4.63 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |