C20H24O5 — CID 54553247
tert-butyl 3-[5-hydroxy-6-(2-methoxy-2-oxoethyl)naphthalen-1-yl]propanoate (PubChem CID 54553247) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl 3-[5-hydroxy-6-(2-methoxy-2-oxoethyl)naphthalen-1-yl]propanoate.
| Compound Name | tert-butyl 3-[5-hydroxy-6-(2-methoxy-2-oxoethyl)naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 54553247 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | tert-butyl 3-[5-hydroxy-6-(2-methoxy-2-oxoethyl)naphthalen-1-yl]propanoate |
| SMILES | COC(=O)Cc1ccc2c(CCC(=O)OC(C)(C)C)cccc2c1O |
| InChI | InChI=1S/C20H24O5/c1-20(2,3)25-17(21)11-9-13-6-5-7-16-15(13)10-8-14(19(16)23)12-18(22)24-4/h5-8,10,23H,9,11-12H2,1-4H3 |
| InChIKey | XFJIGQFLPCBXBK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |