About butane-1,2-diimine
butane-1,2-diimine (PubChem CID 54553916) has the molecular formula C4H8N2
and a molecular weight of 84.12 g/mol. Its IUPAC name is butane-1,2-diimine.
Molecular Properties
| Compound Name | butane-1,2-diimine |
| PubChem CID | 54553916 |
| Molecular Formula | C4H8N2 |
| Molecular Weight | 84.12 g/mol |
| Exact Mass | 84.07 |
| IUPAC Name | butane-1,2-diimine |
| SMILES | [H]/N=C/C(CC)=N/[H] |
| InChI | InChI=1S/C4H8N2/c1-2-4(6)3-5/h3,5-6H,2H2,1H3/b5-3+,6-4+ |
| InChIKey | LPEHQJGMIUSOGA-GGWOSOGESA-N |
| XLogP | 1.07 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.12 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze butane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,2-diimine?
The IUPAC name of butane-1,2-diimine (CID 54553916) is butane-1,2-diimine.
What is the SMILES notation for butane-1,2-diimine?
The canonical SMILES for butane-1,2-diimine is [H]/N=C/C(CC)=N/[H].
What is the InChIKey of butane-1,2-diimine?
The InChIKey is LPEHQJGMIUSOGA-GGWOSOGESA-N. The full InChI is InChI=1S/C4H8N2/c1-2-4(6)3-5/h3,5-6H,2H2,1H3/b5-3+,6-4+.
What are the key properties of butane-1,2-diimine?
butane-1,2-diimine has a molecular weight of 84.12 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,2-diimine is sourced from PubChem (CID 54553916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).