C22H14N2OS3 — CID 54554473
3,5-bis(1-benzothiophen-3-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbaldehyde (PubChem CID 54554473) has the molecular formula C22H14N2OS3 and a molecular weight of 418.57 g/mol. Its IUPAC name is 3,5-bis(1-benzothiophen-3-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbaldehyde.
| Compound Name | 3,5-bis(1-benzothiophen-3-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 54554473 |
| Molecular Formula | C22H14N2OS3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 3,5-bis(1-benzothiophen-3-yl)-5,6-dihydroimidazo[2,1-b][1,3]thiazole-2-carbaldehyde |
| SMILES | O=CC1=C(c2csc3ccccc23)N2C(=NCC2c2csc3ccccc23)S1 |
| InChI | InChI=1S/C22H14N2OS3/c25-10-20-21(16-12-27-19-8-4-2-6-14(16)19)24-17(9-23-22(24)28-20)15-11-26-18-7-3-1-5-13(15)18/h1-8,10-12,17H,9H2 |
| InChIKey | ZMEPJSBNPVJAGB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|