C19H32O4 — CID 54554674
1,2,2,3-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 54554674) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 1,2,2,3-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 1,2,2,3-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 54554674 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 1,2,2,3-tetramethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | CC1OC(=O)CCCC(=O)CCCCCCC2OC2(C)C1(C)C |
| InChI | InChI=1S/C19H32O4/c1-14-18(2,3)19(4)16(23-19)12-8-6-5-7-10-15(20)11-9-13-17(21)22-14/h14,16H,5-13H2,1-4H3 |
| InChIKey | ZMIOXABFEJGOMM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|