About (Z)-3-methylpent-3-en-2-one;pentane
(Z)-3-methylpent-3-en-2-one;pentane (PubChem CID 54554891) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is (Z)-3-methylpent-3-en-2-one;pentane.
Molecular Properties
| Compound Name | (Z)-3-methylpent-3-en-2-one;pentane |
| PubChem CID | 54554891 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (Z)-3-methylpent-3-en-2-one;pentane |
| SMILES | C/C=C(/C)C(C)=O.CCCCC |
| InChI | InChI=1S/C6H10O.C5H12/c1-4-5(2)6(3)7;1-3-5-4-2/h4H,1-3H3;3-5H2,1-2H3/b5-4-; |
| InChIKey | ZMLZXNKHCKOVCE-MKWAYWHRSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methylpent-3-en-2-one;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methylpent-3-en-2-one;pentane?
The IUPAC name of (Z)-3-methylpent-3-en-2-one;pentane (CID 54554891) is (Z)-3-methylpent-3-en-2-one;pentane.
What is the SMILES notation for (Z)-3-methylpent-3-en-2-one;pentane?
The canonical SMILES for (Z)-3-methylpent-3-en-2-one;pentane is C/C=C(/C)C(C)=O.CCCCC.
What is the InChIKey of (Z)-3-methylpent-3-en-2-one;pentane?
The InChIKey is ZMLZXNKHCKOVCE-MKWAYWHRSA-N. The full InChI is InChI=1S/C6H10O.C5H12/c1-4-5(2)6(3)7;1-3-5-4-2/h4H,1-3H3;3-5H2,1-2H3/b5-4-;.
What are the key properties of (Z)-3-methylpent-3-en-2-one;pentane?
(Z)-3-methylpent-3-en-2-one;pentane has a molecular weight of 170.30 g/mol, XLogP of 3.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methylpent-3-en-2-one;pentane is sourced from PubChem (CID 54554891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).