About methyl 2-oxohexadecanoate
methyl 2-oxohexadecanoate (PubChem CID 545549) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is methyl 2-oxohexadecanoate.
Molecular Properties
| Compound Name | methyl 2-oxohexadecanoate |
| PubChem CID | 545549 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | methyl 2-oxohexadecanoate |
| SMILES | CCCCCCCCCCCCCCC(=O)C(=O)OC |
| InChI | InChI=1S/C17H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(19)20-2/h3-15H2,1-2H3 |
| InChIKey | VWRCAQBZONAKSC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-oxohexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-oxohexadecanoate?
The IUPAC name of methyl 2-oxohexadecanoate (CID 545549) is methyl 2-oxohexadecanoate.
What is the SMILES notation for methyl 2-oxohexadecanoate?
The canonical SMILES for methyl 2-oxohexadecanoate is CCCCCCCCCCCCCCC(=O)C(=O)OC.
What is the InChIKey of methyl 2-oxohexadecanoate?
The InChIKey is VWRCAQBZONAKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(18)17(19)20-2/h3-15H2,1-2H3.
What are the key properties of methyl 2-oxohexadecanoate?
methyl 2-oxohexadecanoate has a molecular weight of 284.44 g/mol, XLogP of 4.82, 14 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-oxohexadecanoate is sourced from PubChem (CID 545549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).