About 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one
2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one (PubChem CID 54554918) has the molecular formula C11H10N4O
and a molecular weight of 214.23 g/mol. Its IUPAC name is 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one.
Molecular Properties
| Compound Name | 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one |
| PubChem CID | 54554918 |
| Molecular Formula | C11H10N4O |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one |
| SMILES | C=C(C(=O)C(=C)c1ncc[nH]1)c1ncc[nH]1 |
| InChI | InChI=1S/C11H10N4O/c1-7(10-12-3-4-13-10)9(16)8(2)11-14-5-6-15-11/h3-6H,1-2H2,(H,12,13)(H,14,15) |
| InChIKey | ZMMNZCVJNFESJY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one?
The IUPAC name of 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one (CID 54554918) is 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one.
What is the SMILES notation for 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one?
The canonical SMILES for 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one is C=C(C(=O)C(=C)c1ncc[nH]1)c1ncc[nH]1.
What is the InChIKey of 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one?
The InChIKey is ZMMNZCVJNFESJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O/c1-7(10-12-3-4-13-10)9(16)8(2)11-14-5-6-15-11/h3-6H,1-2H2,(H,12,13)(H,14,15).
What are the key properties of 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one?
2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one has a molecular weight of 214.23 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(1H-imidazol-2-yl)penta-1,4-dien-3-one is sourced from PubChem (CID 54554918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).