C20H39N9O5 — CID 54555233
tert-butyl N-[(2R)-6-(diaminomethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]carbamate (PubChem CID 54555233) has the molecular formula C20H39N9O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is tert-butyl N-[(2R)-6-(diaminomethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-6-(diaminomethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 54555233 |
| Molecular Formula | C20H39N9O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.31 |
| IUPAC Name | tert-butyl N-[(2R)-6-(diaminomethylideneamino)-1-[[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxohexan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCCN=C(N)N)C(=O)NCC(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C20H39N9O5/c1-20(2,3)34-19(33)29-14(8-4-5-9-25-17(21)22)16(32)27-11-15(31)28-13(12-30)7-6-10-26-18(23)24/h12-14H,4-11H2,1-3H3,(H,27,32)(H,28,31)(H,29,33)(H4,21,22,25)(H4,23,24,26)/t13-,14+/m0/s1 |
| InChIKey | ZMSBQLFYYSYXGD-UONOGXRCSA-N |
| XLogP | -1.82 |
| TPSA | 242.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|