About methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate
methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate (PubChem CID 54555482) has the molecular formula C21H38O4Si
and a molecular weight of 382.62 g/mol. Its IUPAC name is methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate.
Molecular Properties
| Compound Name | methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate |
| PubChem CID | 54555482 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate |
| SMILES | COC(=O)C(CC=C(C)CCC=C(C)CO[Si](C)(C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C21H38O4Si/c1-16(13-14-19(18(3)22)20(23)24-7)11-10-12-17(2)15-25-26(8,9)21(4,5)6/h12-13,19H,10-11,14-15H2,1-9H3 |
| InChIKey | ZMWLACBWRYZWSU-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate?
The IUPAC name of methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate (CID 54555482) is methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate.
What is the SMILES notation for methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate?
The canonical SMILES for methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate is COC(=O)C(CC=C(C)CCC=C(C)CO[Si](C)(C)C(C)(C)C)C(C)=O.
What is the InChIKey of methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate?
The InChIKey is ZMWLACBWRYZWSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O4Si/c1-16(13-14-19(18(3)22)20(23)24-7)11-10-12-17(2)15-25-26(8,9)21(4,5)6/h12-13,19H,10-11,14-15H2,1-9H3.
What are the key properties of methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate?
methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate has a molecular weight of 382.62 g/mol, XLogP of 5.45, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-10-[tert-butyl(dimethyl)silyl]oxy-5,9-dimethyldeca-4,8-dienoate is sourced from PubChem (CID 54555482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).