C23H34O5 — CID 54555605
2-hydroxy-7-[(1R,2R)-2-(4-hydroxy-4-propa-1,2-dienyloct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 54555605) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R,2R)-2-(4-hydroxy-4-propa-1,2-dienyloct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 2-hydroxy-7-[(1R,2R)-2-(4-hydroxy-4-propa-1,2-dienyloct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54555605 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-hydroxy-7-[(1R,2R)-2-(4-hydroxy-4-propa-1,2-dienyloct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | C=C=CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O)CCCC |
| InChI | InChI=1S/C23H34O5/c1-3-5-16-23(28,15-4-2)17-9-10-18-13-14-20(24)19(18)11-7-6-8-12-21(25)22(26)27/h6-7,9-10,15,18-19,21,25,28H,2-3,5,8,11-14,16-17H2,1H3,(H,26,27)/t18-,19+,21?,23?/m0/s1 |
| InChIKey | ZMYPPVLMKREWII-BYUXKFDVSA-N |
| XLogP | 3.96 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|