C15H21F9O3 — CID 54556016
(2R)-1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-9-en-2-ol (PubChem CID 54556016) has the molecular formula C15H21F9O3 and a molecular weight of 420.31 g/mol. Its IUPAC name is (2R)-1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-9-en-2-ol.
| Compound Name | (2R)-1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-9-en-2-ol |
|---|---|
| PubChem CID | 54556016 |
| Molecular Formula | C15H21F9O3 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (2R)-1-[2,2,3,3-tetrafluoro-3-(1,1,2,2,2-pentafluoroethoxy)propoxy]dec-9-en-2-ol |
| SMILES | C=CCCCCCC[C@@H](O)COCC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H21F9O3/c1-2-3-4-5-6-7-8-11(25)9-26-10-12(16,17)14(21,22)27-15(23,24)13(18,19)20/h2,11,25H,1,3-10H2/t11-/m1/s1 |
| InChIKey | ZNFQFGGOJPXPAL-LLVKDONJSA-N |
| XLogP | 5.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|