C27H30N4O2S — CID 54556070
4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol (PubChem CID 54556070) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is 4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol.
| Compound Name | 4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol |
|---|---|
| PubChem CID | 54556070 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 4-[4-[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]butyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1CCCCN1CCN(c3nsc4ccccc34)CC1)C1C=CC2C2C=CC12 |
| InChI | InChI=1S/C27H30N4O2S/c32-26-23-19-9-10-20(18-8-7-17(18)19)24(23)27(33)31(26)12-4-3-11-29-13-15-30(16-14-29)25-21-5-1-2-6-22(21)34-28-25/h1-2,5-10,17-20,32-33H,3-4,11-16H2 |
| InChIKey | ZNGGGVFEBFZRRD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|