C12H8F5NO — CID 54556079
4,4,5,5,5-pentafluoro-3-methoxy-2-phenylpent-2-enenitrile (PubChem CID 54556079) has the molecular formula C12H8F5NO and a molecular weight of 277.19 g/mol. Its IUPAC name is 4,4,5,5,5-pentafluoro-3-methoxy-2-phenylpent-2-enenitrile.
| Compound Name | 4,4,5,5,5-pentafluoro-3-methoxy-2-phenylpent-2-enenitrile |
|---|---|
| PubChem CID | 54556079 |
| Molecular Formula | C12H8F5NO |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 4,4,5,5,5-pentafluoro-3-methoxy-2-phenylpent-2-enenitrile |
| SMILES | COC(=C(C#N)c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H8F5NO/c1-19-10(11(13,14)12(15,16)17)9(7-18)8-5-3-2-4-6-8/h2-6H,1H3 |
| InChIKey | ZNGJTFVPSLGQIC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|