C18H17N3O3S — CID 54556098
methyl (2S)-2-[(2-methylnaphthalen-1-yl)-(thiadiazole-4-carbonyl)amino]propanoate (PubChem CID 54556098) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is methyl (2S)-2-[(2-methylnaphthalen-1-yl)-(thiadiazole-4-carbonyl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(2-methylnaphthalen-1-yl)-(thiadiazole-4-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 54556098 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | methyl (2S)-2-[(2-methylnaphthalen-1-yl)-(thiadiazole-4-carbonyl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)N(C(=O)c1csnn1)c1c(C)ccc2ccccc12 |
| InChI | InChI=1S/C18H17N3O3S/c1-11-8-9-13-6-4-5-7-14(13)16(11)21(12(2)18(23)24-3)17(22)15-10-25-20-19-15/h4-10,12H,1-3H3/t12-/m0/s1 |
| InChIKey | ZNGUGXMLIWIMCN-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |