About 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one
2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one (PubChem CID 54556101) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one.
Molecular Properties
| Compound Name | 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one |
| PubChem CID | 54556101 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one |
| SMILES | CCC(C)C1=NC2(CCCC2)C(=O)N1 |
| InChI | InChI=1S/C11H18N2O/c1-3-8(2)9-12-10(14)11(13-9)6-4-5-7-11/h8H,3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | ZNGUZQYBEDDLOG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one?
The IUPAC name of 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one (CID 54556101) is 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one.
What is the SMILES notation for 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one?
The canonical SMILES for 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one is CCC(C)C1=NC2(CCCC2)C(=O)N1.
What is the InChIKey of 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one?
The InChIKey is ZNGUZQYBEDDLOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-3-8(2)9-12-10(14)11(13-9)6-4-5-7-11/h8H,3-7H2,1-2H3,(H,12,13,14).
What are the key properties of 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one?
2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one has a molecular weight of 194.28 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-1,3-diazaspiro[4.4]non-1-en-4-one is sourced from PubChem (CID 54556101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).