C20H20O4 — CID 54557296
3-[2-(5-methyl-2-propoxyphenyl)-2-oxoethyl]-3H-2-benzofuran-1-one (PubChem CID 54557296) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-[2-(5-methyl-2-propoxyphenyl)-2-oxoethyl]-3H-2-benzofuran-1-one.
| Compound Name | 3-[2-(5-methyl-2-propoxyphenyl)-2-oxoethyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 54557296 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-[2-(5-methyl-2-propoxyphenyl)-2-oxoethyl]-3H-2-benzofuran-1-one |
| SMILES | CCCOc1ccc(C)cc1C(=O)CC1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C20H20O4/c1-3-10-23-18-9-8-13(2)11-16(18)17(21)12-19-14-6-4-5-7-15(14)20(22)24-19/h4-9,11,19H,3,10,12H2,1-2H3 |
| InChIKey | ZOBLMCHLOAMHKD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |