C29H24N4O6S — CID 54557635
benzhydryl (5R,6S)-4-diazo-3-methyl-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54557635) has the molecular formula C29H24N4O6S and a molecular weight of 556.60 g/mol. Its IUPAC name is benzhydryl (5R,6S)-4-diazo-3-methyl-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (5R,6S)-4-diazo-3-methyl-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54557635 |
| Molecular Formula | C29H24N4O6S |
| Molecular Weight | 556.60 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | benzhydryl (5R,6S)-4-diazo-3-methyl-5,8-dioxo-7-[(2-phenoxyacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)COc3ccccc3)[C@@H]2[S@@](=O)C1=[N+]=[N-] |
| InChI | InChI=1S/C29H24N4O6S/c1-18-24(29(36)39-25(19-11-5-2-6-12-19)20-13-7-3-8-14-20)33-27(35)23(28(33)40(37)26(18)32-30)31-22(34)17-38-21-15-9-4-10-16-21/h2-16,23,25,28H,17H2,1H3,(H,31,34)/t23?,28-,40-/m0/s1 |
| InChIKey | ZOGYVFSPOJPLGY-GJQWMXNNSA-N |
| XLogP | 2.72 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.60 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|