About 5-ethenylpyrrolidin-3-ol
5-ethenylpyrrolidin-3-ol (PubChem CID 54557774) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 5-ethenylpyrrolidin-3-ol.
Molecular Properties
| Compound Name | 5-ethenylpyrrolidin-3-ol |
| PubChem CID | 54557774 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 5-ethenylpyrrolidin-3-ol |
| SMILES | C=CC1CC(O)CN1 |
| InChI | InChI=1S/C6H11NO/c1-2-5-3-6(8)4-7-5/h2,5-8H,1,3-4H2 |
| InChIKey | AUMFHSGHKMAQIY-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenylpyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylpyrrolidin-3-ol?
The IUPAC name of 5-ethenylpyrrolidin-3-ol (CID 54557774) is 5-ethenylpyrrolidin-3-ol.
What is the SMILES notation for 5-ethenylpyrrolidin-3-ol?
The canonical SMILES for 5-ethenylpyrrolidin-3-ol is C=CC1CC(O)CN1.
What is the InChIKey of 5-ethenylpyrrolidin-3-ol?
The InChIKey is AUMFHSGHKMAQIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-2-5-3-6(8)4-7-5/h2,5-8H,1,3-4H2.
What are the key properties of 5-ethenylpyrrolidin-3-ol?
5-ethenylpyrrolidin-3-ol has a molecular weight of 113.16 g/mol, XLogP of -0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylpyrrolidin-3-ol is sourced from PubChem (CID 54557774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).