About 1,1-dinitropropane-1,2,3-triol
1,1-dinitropropane-1,2,3-triol (PubChem CID 54558064) has the molecular formula C3H6N2O7
and a molecular weight of 182.09 g/mol. Its IUPAC name is 1,1-dinitropropane-1,2,3-triol.
Molecular Properties
| Compound Name | 1,1-dinitropropane-1,2,3-triol |
| PubChem CID | 54558064 |
| Molecular Formula | C3H6N2O7 |
| Molecular Weight | 182.09 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 1,1-dinitropropane-1,2,3-triol |
| SMILES | O=[N+]([O-])C(O)(C(O)CO)[N+](=O)[O-] |
| InChI | InChI=1S/C3H6N2O7/c6-1-2(7)3(8,4(9)10)5(11)12/h2,6-8H,1H2 |
| InChIKey | ZOOHCSJRXIBMFX-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 146.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.09 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dinitropropane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dinitropropane-1,2,3-triol?
The IUPAC name of 1,1-dinitropropane-1,2,3-triol (CID 54558064) is 1,1-dinitropropane-1,2,3-triol.
What is the SMILES notation for 1,1-dinitropropane-1,2,3-triol?
The canonical SMILES for 1,1-dinitropropane-1,2,3-triol is O=[N+]([O-])C(O)(C(O)CO)[N+](=O)[O-].
What is the InChIKey of 1,1-dinitropropane-1,2,3-triol?
The InChIKey is ZOOHCSJRXIBMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O7/c6-1-2(7)3(8,4(9)10)5(11)12/h2,6-8H,1H2.
What are the key properties of 1,1-dinitropropane-1,2,3-triol?
1,1-dinitropropane-1,2,3-triol has a molecular weight of 182.09 g/mol, XLogP of -2.46, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dinitropropane-1,2,3-triol is sourced from PubChem (CID 54558064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).