About tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate
tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate (PubChem CID 54558277) has the molecular formula C32H58O11
and a molecular weight of 618.81 g/mol. Its IUPAC name is tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate.
Molecular Properties
| Compound Name | tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
| PubChem CID | 54558277 |
| Molecular Formula | C32H58O11 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.40 |
| IUPAC Name | tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCC(COC(=O)CC(CC(=O)OCC(CCCC)OCC)(OC(C)=O)C(=O)OCC(CCCC)OCC)OCC |
| InChI | InChI=1S/C32H58O11/c1-8-14-17-26(37-11-4)22-40-29(34)20-32(43-25(7)33,31(36)42-24-28(39-13-6)19-16-10-3)21-30(35)41-23-27(38-12-5)18-15-9-2/h26-28H,8-24H2,1-7H3 |
| InChIKey | ZOSJSEXNVGLJGE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate?
The IUPAC name of tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate (CID 54558277) is tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate.
What is the SMILES notation for tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate?
The canonical SMILES for tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate is CCCCC(COC(=O)CC(CC(=O)OCC(CCCC)OCC)(OC(C)=O)C(=O)OCC(CCCC)OCC)OCC.
What is the InChIKey of tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate?
The InChIKey is ZOSJSEXNVGLJGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H58O11/c1-8-14-17-26(37-11-4)22-40-29(34)20-32(43-25(7)33,31(36)42-24-28(39-13-6)19-16-10-3)21-30(35)41-23-27(38-12-5)18-15-9-2/h26-28H,8-24H2,1-7H3.
What are the key properties of tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate?
tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate has a molecular weight of 618.81 g/mol, XLogP of 5.48, 27 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-ethoxyhexyl) 2-acetyloxypropane-1,2,3-tricarboxylate is sourced from PubChem (CID 54558277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).