About 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene
2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene (PubChem CID 54558536) has the molecular formula C20H10BrClF6
and a molecular weight of 479.65 g/mol. Its IUPAC name is 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene.
Molecular Properties
| Compound Name | 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene |
| PubChem CID | 54558536 |
| Molecular Formula | C20H10BrClF6 |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene |
| SMILES | FC(F)(F)c1ccccc1-c1ccc(Cl)c(Br)c1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H10BrClF6/c21-18-16(22)10-9-12(11-5-1-3-7-14(11)19(23,24)25)17(18)13-6-2-4-8-15(13)20(26,27)28/h1-10H |
| InChIKey | GOYPSOXGZKFRPU-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene?
The IUPAC name of 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene (CID 54558536) is 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene.
What is the SMILES notation for 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene?
The canonical SMILES for 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene is FC(F)(F)c1ccccc1-c1ccc(Cl)c(Br)c1-c1ccccc1C(F)(F)F.
What is the InChIKey of 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene?
The InChIKey is GOYPSOXGZKFRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10BrClF6/c21-18-16(22)10-9-12(11-5-1-3-7-14(11)19(23,24)25)17(18)13-6-2-4-8-15(13)20(26,27)28/h1-10H.
What are the key properties of 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene?
2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene has a molecular weight of 479.65 g/mol, XLogP of 8.47, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-chloro-3,4-bis[2-(trifluoromethyl)phenyl]benzene is sourced from PubChem (CID 54558536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).