C19H31N7O3S — CID 54559165
N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(6S)-4-methyl-6-(methylamino)-7-oxo-1,4-diazepan-1-yl]acetamide (PubChem CID 54559165) has the molecular formula C19H31N7O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(6S)-4-methyl-6-(methylamino)-7-oxo-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(6S)-4-methyl-6-(methylamino)-7-oxo-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 54559165 |
| Molecular Formula | C19H31N7O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | N-[(2S)-5-(1-aminoethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-2-[(6S)-4-methyl-6-(methylamino)-7-oxo-1,4-diazepan-1-yl]acetamide |
| SMILES | CN[C@H]1CN(C)CCN(CC(=O)N[C@@H](CCC/N=C(\C)N)C(=O)c2nccs2)C1=O |
| InChI | InChI=1S/C19H31N7O3S/c1-13(20)22-6-4-5-14(17(28)18-23-7-10-30-18)24-16(27)12-26-9-8-25(3)11-15(21-2)19(26)29/h7,10,14-15,21H,4-6,8-9,11-12H2,1-3H3,(H2,20,22)(H,24,27)/t14-,15-/m0/s1 |
| InChIKey | ZPHZTTVUQNFVRE-GJZGRUSLSA-N |
| XLogP | -0.67 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|