C28H29ClN4O3 — CID 5455925
[(3R,3aS,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone (PubChem CID 5455925) has the molecular formula C28H29ClN4O3 and a molecular weight of 505.02 g/mol. Its IUPAC name is [(3R,3aS,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone.
| Compound Name | [(3R,3aS,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 5455925 |
| Molecular Formula | C28H29ClN4O3 |
| Molecular Weight | 505.02 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | [(3R,3aS,7E)-3-(2-methoxyphenyl)-7-[(2-methoxyphenyl)methylidene]-3a,4,5,6-tetrahydro-3H-indazol-2-yl]-(4-chloro-1-ethylpyrazol-3-yl)methanone |
| SMILES | CCn1cc(Cl)c(C(=O)N2N=C3/C(=C/c4ccccc4OC)CCC[C@H]3[C@@H]2c2ccccc2OC)n1 |
| InChI | InChI=1S/C28H29ClN4O3/c1-4-32-17-22(29)26(30-32)28(34)33-27(20-12-6-8-15-24(20)36-3)21-13-9-11-19(25(21)31-33)16-18-10-5-7-14-23(18)35-2/h5-8,10,12,14-17,21,27H,4,9,11,13H2,1-3H3/b19-16+/t21-,27+/m1/s1 |
| InChIKey | ZNPXLIIHUNOPGN-JUKMZFTMSA-N |
| XLogP | 6.01 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.02 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |