C43H48N2O2 — CID 54560375
(10bR)-4,10b-dimethyl-8-(2-methylphenyl)-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one;(10bR)-10b-methyl-8-(2-methylphenyl)-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one (PubChem CID 54560375) has the molecular formula C43H48N2O2 and a molecular weight of 624.87 g/mol. Its IUPAC name is (10bR)-4,10b-dimethyl-8-(2-methylphenyl)-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one;(10bR)-10b-methyl-8-(2-methylphenyl)-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | (10bR)-4,10b-dimethyl-8-(2-methylphenyl)-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one;(10bR)-10b-methyl-8-(2-methylphenyl)-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54560375 |
| Molecular Formula | C43H48N2O2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | (10bR)-4,10b-dimethyl-8-(2-methylphenyl)-2,4a,5,6-tetrahydro-1H-benzo[f]quinolin-3-one;(10bR)-10b-methyl-8-(2-methylphenyl)-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
| SMILES | Cc1ccccc1-c1ccc2c(c1)CCC1N(C)C(=O)CC[C@]21C.Cc1ccccc1-c1ccc2c(c1)CCC1NC(=O)CC[C@]21C |
| InChI | InChI=1S/C22H25NO.C21H23NO/c1-15-6-4-5-7-18(15)16-8-10-19-17(14-16)9-11-20-22(19,2)13-12-21(24)23(20)3;1-14-5-3-4-6-17(14)15-7-9-18-16(13-15)8-10-19-21(18,2)12-11-20(23)22-19/h4-8,10,14,20H,9,11-13H2,1-3H3;3-7,9,13,19H,8,10-12H2,1-2H3,(H,22,23)/t20?,22-;19?,21-/m11/s1 |
| InChIKey | ZQCYKZPFGFHJTO-TZDQQMRXSA-N |
| XLogP | 8.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |