C14H22N4O2S — CID 54560595
[[(3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]thiolan-2-ylidene]amino] N,N-dimethylcarbamate (PubChem CID 54560595) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is [[(3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]thiolan-2-ylidene]amino] N,N-dimethylcarbamate.
| Compound Name | [[(3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]thiolan-2-ylidene]amino] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 54560595 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [[(3R,4R)-3-ethyl-4-[(3-methylimidazol-4-yl)methyl]thiolan-2-ylidene]amino] N,N-dimethylcarbamate |
| SMILES | CC[C@H]1C(=NOC(=O)N(C)C)SC[C@@H]1Cc1cncn1C |
| InChI | InChI=1S/C14H22N4O2S/c1-5-12-10(6-11-7-15-9-18(11)4)8-21-13(12)16-20-14(19)17(2)3/h7,9-10,12H,5-6,8H2,1-4H3/t10-,12+/m0/s1 |
| InChIKey | ZQGNORCHCJYPHC-CMPLNLGQSA-N |
| XLogP | 2.36 |
| TPSA | 59.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|