About 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one
4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one (PubChem CID 54560902) has the molecular formula C32H27NO4S
and a molecular weight of 521.64 g/mol. Its IUPAC name is 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
| PubChem CID | 54560902 |
| Molecular Formula | C32H27NO4S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one |
| SMILES | CC(=O)COc1ccc(Cc2sc(=O)n(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2O)cc1 |
| InChI | InChI=1S/C32H27NO4S/c1-23(34)22-37-28-19-17-24(18-20-28)21-29-30(35)33(31(36)38-29)32(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-20,35H,21-22H2,1H3 |
| InChIKey | ZQLXDGDBSTZDQN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one?
The IUPAC name of 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one (CID 54560902) is 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one.
What is the SMILES notation for 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one?
The canonical SMILES for 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one is CC(=O)COc1ccc(Cc2sc(=O)n(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2O)cc1.
What is the InChIKey of 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one?
The InChIKey is ZQLXDGDBSTZDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H27NO4S/c1-23(34)22-37-28-19-17-24(18-20-28)21-29-30(35)33(31(36)38-29)32(25-11-5-2-6-12-25,26-13-7-3-8-14-26)27-15-9-4-10-16-27/h2-20,35H,21-22H2,1H3.
What are the key properties of 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one?
4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one has a molecular weight of 521.64 g/mol, XLogP of 6.01, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-[[4-(2-oxopropoxy)phenyl]methyl]-3-trityl-1,3-thiazol-2-one is sourced from PubChem (CID 54560902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).