C21H39N3O4 — CID 54560986
N-[3,3-diethyl-1-(methylamino)-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide (PubChem CID 54560986) has the molecular formula C21H39N3O4 and a molecular weight of 397.56 g/mol. Its IUPAC name is N-[3,3-diethyl-1-(methylamino)-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide.
| Compound Name | N-[3,3-diethyl-1-(methylamino)-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide |
|---|---|
| PubChem CID | 54560986 |
| Molecular Formula | C21H39N3O4 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.29 |
| IUPAC Name | N-[3,3-diethyl-1-(methylamino)-1-oxopentan-2-yl]-N'-hydroxy-2-(2-methylpropyl)-3-prop-2-enylbutanediamide |
| SMILES | C=CCC(C(=O)NO)C(CC(C)C)C(=O)NC(C(=O)NC)C(CC)(CC)CC |
| InChI | InChI=1S/C21H39N3O4/c1-8-12-15(19(26)24-28)16(13-14(5)6)18(25)23-17(20(27)22-7)21(9-2,10-3)11-4/h8,14-17,28H,1,9-13H2,2-7H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | ZQNLIQBACGSGBY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|