About N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine
N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine (PubChem CID 54561117) has the molecular formula C18H20N6O
and a molecular weight of 336.40 g/mol. Its IUPAC name is N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine |
| PubChem CID | 54561117 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine |
| SMILES | CN(Cc1ccccc1)c1nc(N2CCOCC2)c2ncncc2n1 |
| InChI | InChI=1S/C18H20N6O/c1-23(12-14-5-3-2-4-6-14)18-21-15-11-19-13-20-16(15)17(22-18)24-7-9-25-10-8-24/h2-6,11,13H,7-10,12H2,1H3 |
| InChIKey | ZQPPHQXCLFWGEV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine?
The IUPAC name of N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine (CID 54561117) is N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine.
What is the SMILES notation for N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine?
The canonical SMILES for N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine is CN(Cc1ccccc1)c1nc(N2CCOCC2)c2ncncc2n1.
What is the InChIKey of N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine?
The InChIKey is ZQPPHQXCLFWGEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N6O/c1-23(12-14-5-3-2-4-6-14)18-21-15-11-19-13-20-16(15)17(22-18)24-7-9-25-10-8-24/h2-6,11,13H,7-10,12H2,1H3.
What are the key properties of N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine?
N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine has a molecular weight of 336.40 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-methyl-4-morpholin-4-ylpyrimido[5,4-d]pyrimidin-2-amine is sourced from PubChem (CID 54561117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).