About but-2-enyl carbonochloridate
but-2-enyl carbonochloridate (PubChem CID 54561314) has the molecular formula C5H7ClO2
and a molecular weight of 134.56 g/mol. Its IUPAC name is but-2-enyl carbonochloridate.
Molecular Properties
| Compound Name | but-2-enyl carbonochloridate |
| PubChem CID | 54561314 |
| Molecular Formula | C5H7ClO2 |
| Molecular Weight | 134.56 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | but-2-enyl carbonochloridate |
| SMILES | CC=CCOC(=O)Cl |
| InChI | InChI=1S/C5H7ClO2/c1-2-3-4-8-5(6)7/h2-3H,4H2,1H3 |
| InChIKey | ZQSWSIKNFRZKGQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.56 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-2-enyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enyl carbonochloridate?
The IUPAC name of but-2-enyl carbonochloridate (CID 54561314) is but-2-enyl carbonochloridate.
What is the SMILES notation for but-2-enyl carbonochloridate?
The canonical SMILES for but-2-enyl carbonochloridate is CC=CCOC(=O)Cl.
What is the InChIKey of but-2-enyl carbonochloridate?
The InChIKey is ZQSWSIKNFRZKGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClO2/c1-2-3-4-8-5(6)7/h2-3H,4H2,1H3.
What are the key properties of but-2-enyl carbonochloridate?
but-2-enyl carbonochloridate has a molecular weight of 134.56 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enyl carbonochloridate is sourced from PubChem (CID 54561314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).