C23H32N2O3S — CID 54561377
[4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylbutyl] sulfamate (PubChem CID 54561377) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is [4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylbutyl] sulfamate.
| Compound Name | [4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylbutyl] sulfamate |
|---|---|
| PubChem CID | 54561377 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | [4-[(2S,6R)-2,6-dimethylpiperidin-1-yl]-1,1-diphenylbutyl] sulfamate |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCC(OS(N)(=O)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H32N2O3S/c1-19-11-9-12-20(2)25(19)18-10-17-23(28-29(24,26)27,21-13-5-3-6-14-21)22-15-7-4-8-16-22/h3-8,13-16,19-20H,9-12,17-18H2,1-2H3,(H2,24,26,27)/t19-,20+ |
| InChIKey | ZQUDAFDFHWWQJY-BGYRXZFFSA-N |
| XLogP | 4.19 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |