C18H22O2 — CID 54561614
hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-13-ene-4-carboxylic acid (PubChem CID 54561614) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-13-ene-4-carboxylic acid.
| Compound Name | hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-13-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 54561614 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-13-ene-4-carboxylic acid |
| SMILES | O=C(O)C1CC2CC1C1C3CC(C4C3=C3CCC4C3)C21 |
| InChI | InChI=1S/C18H22O2/c19-18(20)11-5-9-4-10(11)17-13-6-12(16(9)17)14-7-1-2-8(3-7)15(13)14/h7,9-14,16-17H,1-6H2,(H,19,20) |
| InChIKey | ZQXZHAWJECZGIT-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|