About (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone
(5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone (PubChem CID 54561645) has the molecular formula C14H12F3NO4S
and a molecular weight of 347.31 g/mol. Its IUPAC name is (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone.
Molecular Properties
| Compound Name | (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone |
| PubChem CID | 54561645 |
| Molecular Formula | C14H12F3NO4S |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone |
| SMILES | CCc1oncc1C(=O)c1ccc(S(C)(=O)=O)cc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO4S/c1-3-12-10(7-18-22-12)13(19)9-5-4-8(23(2,20)21)6-11(9)14(15,16)17/h4-7H,3H2,1-2H3 |
| InChIKey | ZQYQZQJWOOCMEM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone?
The IUPAC name of (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone (CID 54561645) is (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone.
What is the SMILES notation for (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone?
The canonical SMILES for (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone is CCc1oncc1C(=O)c1ccc(S(C)(=O)=O)cc1C(F)(F)F.
What is the InChIKey of (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone?
The InChIKey is ZQYQZQJWOOCMEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3NO4S/c1-3-12-10(7-18-22-12)13(19)9-5-4-8(23(2,20)21)6-11(9)14(15,16)17/h4-7H,3H2,1-2H3.
What are the key properties of (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone?
(5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone has a molecular weight of 347.31 g/mol, XLogP of 2.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethyl-1,2-oxazol-4-yl)-[4-methylsulfonyl-2-(trifluoromethyl)phenyl]methanone is sourced from PubChem (CID 54561645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).