C13H11IN2O8S — CID 54561674
2,5-dihydroxy-1-[4-[(2-iodoacetyl)amino]benzoyl]oxypyrrole-3-sulfonic acid (PubChem CID 54561674) has the molecular formula C13H11IN2O8S and a molecular weight of 482.21 g/mol. Its IUPAC name is 2,5-dihydroxy-1-[4-[(2-iodoacetyl)amino]benzoyl]oxypyrrole-3-sulfonic acid.
| Compound Name | 2,5-dihydroxy-1-[4-[(2-iodoacetyl)amino]benzoyl]oxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 54561674 |
| Molecular Formula | C13H11IN2O8S |
| Molecular Weight | 482.21 g/mol |
| Exact Mass | 481.93 |
| IUPAC Name | 2,5-dihydroxy-1-[4-[(2-iodoacetyl)amino]benzoyl]oxypyrrole-3-sulfonic acid |
| SMILES | O=C(CI)Nc1ccc(C(=O)On2c(O)cc(S(=O)(=O)O)c2O)cc1 |
| InChI | InChI=1S/C13H11IN2O8S/c14-6-10(17)15-8-3-1-7(2-4-8)13(20)24-16-11(18)5-9(12(16)19)25(21,22)23/h1-5,18-19H,6H2,(H,15,17)(H,21,22,23) |
| InChIKey | ZQZGBSLEAMKVIC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.21 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|