C13H17NO — CID 54561720
(3aS,9aR)-8-methoxy-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole (PubChem CID 54561720) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (3aS,9aR)-8-methoxy-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole.
| Compound Name | (3aS,9aR)-8-methoxy-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole |
|---|---|
| PubChem CID | 54561720 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3aS,9aR)-8-methoxy-2,3,3a,4,9,9a-hexahydro-1H-benzo[f]indole |
| SMILES | COc1cccc2c1C[C@H]1NCC[C@@H]1C2 |
| InChI | InChI=1S/C13H17NO/c1-15-13-4-2-3-9-7-10-5-6-14-12(10)8-11(9)13/h2-4,10,12,14H,5-8H2,1H3/t10-,12-/m1/s1 |
| InChIKey | ZRAAWGRXIFEVNU-ZYHUDNBSSA-N |
| XLogP | 1.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |