2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride

C15H12ClNO4 — CID 54561819

IUPAC2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride
SMILESO=C(Cl)Cc1ccc([N+](=O)[O-])c(OCc2ccccc2)c1
InChIInChI=1S/C15H12ClNO4/c16-15(18)9-12-6-7-13(17(19)20)14(8-12)21-10-11-4-2-1-3-5-11/h1-8H,9-10H2
InChIKeyZRBVEEOYBJMVFG-UHFFFAOYSA-N
MW305.72 g/mol
LogP3.48
Rot. Bonds6

About 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride

2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride (PubChem CID 54561819) has the molecular formula C15H12ClNO4 and a molecular weight of 305.72 g/mol. Its IUPAC name is 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride.

Molecular Properties

Compound Name2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride
PubChem CID54561819
Molecular FormulaC15H12ClNO4
Molecular Weight305.72 g/mol
Exact Mass305.05
IUPAC Name2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride
SMILESO=C(Cl)Cc1ccc([N+](=O)[O-])c(OCc2ccccc2)c1
InChIInChI=1S/C15H12ClNO4/c16-15(18)9-12-6-7-13(17(19)20)14(8-12)21-10-11-4-2-1-3-5-11/h1-8H,9-10H2
InChIKeyZRBVEEOYBJMVFG-UHFFFAOYSA-N
XLogP3.48
TPSA69.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.72
LogP ≤ 53.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride?
The IUPAC name of 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride (CID 54561819) is 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride.
What is the SMILES notation for 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride?
The canonical SMILES for 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride is O=C(Cl)Cc1ccc([N+](=O)[O-])c(OCc2ccccc2)c1.
What is the InChIKey of 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride?
The InChIKey is ZRBVEEOYBJMVFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClNO4/c16-15(18)9-12-6-7-13(17(19)20)14(8-12)21-10-11-4-2-1-3-5-11/h1-8H,9-10H2.
What are the key properties of 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride?
2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride has a molecular weight of 305.72 g/mol, XLogP of 3.48, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-nitro-3-phenylmethoxyphenyl)acetyl chloride is sourced from PubChem (CID 54561819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).