C30H37F4N5 — CID 54561991
5-(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin (PubChem CID 54561991) has the molecular formula C30H37F4N5 and a molecular weight of 543.65 g/mol. Its IUPAC name is 5-(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin.
| Compound Name | 5-(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin |
|---|---|
| PubChem CID | 54561991 |
| Molecular Formula | C30H37F4N5 |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | 5-(2,3,5,6-tetrafluoro-4-pyridin-2-ylphenyl)-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin |
| SMILES | Fc1c(F)c(C2C3CCC(CC4CCC(CC5CCC(N5)C5CCC2N5)N4)N3)c(F)c(F)c1-c1ccccn1 |
| InChI | InChI=1S/C30H37F4N5/c31-27-25(21-3-1-2-12-35-21)28(32)30(34)26(29(27)33)24-22-9-7-18(38-22)14-16-5-4-15(36-16)13-17-6-8-19(37-17)20-10-11-23(24)39-20/h1-3,12,15-20,22-24,36-39H,4-11,13-14H2 |
| InChIKey | CWLQWGJHJXDANR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|