C25H35NO7 — CID 54562624
3-(3,4,5-trimethoxyphenyl)propyl 2-(3,3-dimethyl-2-oxobutanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate (PubChem CID 54562624) has the molecular formula C25H35NO7 and a molecular weight of 461.56 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propyl 2-(3,3-dimethyl-2-oxobutanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propyl 2-(3,3-dimethyl-2-oxobutanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
|---|---|
| PubChem CID | 54562624 |
| Molecular Formula | C25H35NO7 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propyl 2-(3,3-dimethyl-2-oxobutanoyl)-2-azabicyclo[2.2.1]heptane-3-carboxylate |
| SMILES | COc1cc(CCCOC(=O)C2C3CCC(C3)N2C(=O)C(=O)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C25H35NO7/c1-25(2,3)22(27)23(28)26-17-10-9-16(14-17)20(26)24(29)33-11-7-8-15-12-18(30-4)21(32-6)19(13-15)31-5/h12-13,16-17,20H,7-11,14H2,1-6H3 |
| InChIKey | ZRPONHOPDGNZLY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|