C25H31N7O2 — CID 54562806
(2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[2-(1H-imidazol-5-yl)ethylamino]pentanamide (PubChem CID 54562806) has the molecular formula C25H31N7O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[2-(1H-imidazol-5-yl)ethylamino]pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[2-(1H-imidazol-5-yl)ethylamino]pentanamide |
|---|---|
| PubChem CID | 54562806 |
| Molecular Formula | C25H31N7O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-N-(2,2-diphenylacetyl)-2-[2-(1H-imidazol-5-yl)ethylamino]pentanamide |
| SMILES | NC(N)=NCCC[C@H](NCCc1cnc[nH]1)C(=O)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N7O2/c26-25(27)30-14-7-12-21(29-15-13-20-16-28-17-31-20)23(33)32-24(34)22(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,16-17,21-22,29H,7,12-15H2,(H,28,31)(H4,26,27,30)(H,32,33,34)/t21-/m0/s1 |
| InChIKey | ZRSRGDSTIHKUKE-NRFANRHFSA-N |
| XLogP | 1.44 |
| TPSA | 151.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|