About 1-hydroxy-1,3-diazinane-2,5-dione
1-hydroxy-1,3-diazinane-2,5-dione (PubChem CID 54563837) has the molecular formula C4H6N2O3
and a molecular weight of 130.10 g/mol. Its IUPAC name is 1-hydroxy-1,3-diazinane-2,5-dione.
Molecular Properties
| Compound Name | 1-hydroxy-1,3-diazinane-2,5-dione |
| PubChem CID | 54563837 |
| Molecular Formula | C4H6N2O3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | 1-hydroxy-1,3-diazinane-2,5-dione |
| SMILES | O=C1CNC(=O)N(O)C1 |
| InChI | InChI=1S/C4H6N2O3/c7-3-1-5-4(8)6(9)2-3/h9H,1-2H2,(H,5,8) |
| InChIKey | MJXXKZPNIHLRSD-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-1,3-diazinane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-1,3-diazinane-2,5-dione?
The IUPAC name of 1-hydroxy-1,3-diazinane-2,5-dione (CID 54563837) is 1-hydroxy-1,3-diazinane-2,5-dione.
What is the SMILES notation for 1-hydroxy-1,3-diazinane-2,5-dione?
The canonical SMILES for 1-hydroxy-1,3-diazinane-2,5-dione is O=C1CNC(=O)N(O)C1.
What is the InChIKey of 1-hydroxy-1,3-diazinane-2,5-dione?
The InChIKey is MJXXKZPNIHLRSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O3/c7-3-1-5-4(8)6(9)2-3/h9H,1-2H2,(H,5,8).
What are the key properties of 1-hydroxy-1,3-diazinane-2,5-dione?
1-hydroxy-1,3-diazinane-2,5-dione has a molecular weight of 130.10 g/mol, XLogP of -1.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-1,3-diazinane-2,5-dione is sourced from PubChem (CID 54563837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).