About tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate
tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate (PubChem CID 54564124) has the molecular formula C16H31NO2
and a molecular weight of 269.43 g/mol. Its IUPAC name is tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate |
| PubChem CID | 54564124 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate |
| SMILES | CC(C)CC=CC(CC(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-12(2)9-8-10-14(11-13(3)4)17-15(18)19-16(5,6)7/h8,10,12-14H,9,11H2,1-7H3,(H,17,18) |
| InChIKey | ZSQBDRSNMOOXTO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate?
The IUPAC name of tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate (CID 54564124) is tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate.
What is the SMILES notation for tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate?
The canonical SMILES for tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate is CC(C)CC=CC(CC(C)C)NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate?
The InChIKey is ZSQBDRSNMOOXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31NO2/c1-12(2)9-8-10-14(11-13(3)4)17-15(18)19-16(5,6)7/h8,10,12-14H,9,11H2,1-7H3,(H,17,18).
What are the key properties of tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate?
tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate has a molecular weight of 269.43 g/mol, XLogP of 4.53, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(2,8-dimethylnon-5-en-4-yl)carbamate is sourced from PubChem (CID 54564124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).