C26H20N4O4 — CID 54564257
5-phenyl-21,22,23,24-tetrahydroporphyrin-2,10,15,20-tetrol (PubChem CID 54564257) has the molecular formula C26H20N4O4 and a molecular weight of 452.47 g/mol. Its IUPAC name is 5-phenyl-21,22,23,24-tetrahydroporphyrin-2,10,15,20-tetrol.
| Compound Name | 5-phenyl-21,22,23,24-tetrahydroporphyrin-2,10,15,20-tetrol |
|---|---|
| PubChem CID | 54564257 |
| Molecular Formula | C26H20N4O4 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 5-phenyl-21,22,23,24-tetrahydroporphyrin-2,10,15,20-tetrol |
| SMILES | OC1=c2ccc([nH]2)=C(O)c2ccc([nH]2)C(O)=c2[nH]c(cc2O)=C(c2ccccc2)c2ccc1[nH]2 |
| InChI | InChI=1S/C26H20N4O4/c31-21-12-20-22(13-4-2-1-3-5-13)14-6-7-15(27-14)24(32)16-8-9-17(28-16)25(33)18-10-11-19(29-18)26(34)23(21)30-20/h1-12,27-34H |
| InChIKey | KDSGXLGEVCYHBX-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |