About methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate
methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate (PubChem CID 54564300) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate |
| PubChem CID | 54564300 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate |
| SMILES | COC(=O)CC[C@@H]1CCC(=O)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C10H14O4/c1-13-8(12)5-3-6-2-4-7(11)10-9(6)14-10/h6,9-10H,2-5H2,1H3/t6-,9-,10+/m0/s1 |
| InChIKey | ZSSWZKDKJOXDGL-JMOVZRAMSA-N |
| XLogP | 0.69 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate?
The IUPAC name of methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate (CID 54564300) is methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate.
What is the SMILES notation for methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate?
The canonical SMILES for methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate is COC(=O)CC[C@@H]1CCC(=O)[C@H]2O[C@@H]12.
What is the InChIKey of methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate?
The InChIKey is ZSSWZKDKJOXDGL-JMOVZRAMSA-N. The full InChI is InChI=1S/C10H14O4/c1-13-8(12)5-3-6-2-4-7(11)10-9(6)14-10/h6,9-10H,2-5H2,1H3/t6-,9-,10+/m0/s1.
What are the key properties of methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate?
methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate has a molecular weight of 198.22 g/mol, XLogP of 0.69, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1S,2S,6S)-5-oxo-7-oxabicyclo[4.1.0]heptan-2-yl]propanoate is sourced from PubChem (CID 54564300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).