C20H16F3N3O4S — CID 54564555
4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidene-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrimidine-5-carboxamide (PubChem CID 54564555) has the molecular formula C20H16F3N3O4S and a molecular weight of 451.43 g/mol. Its IUPAC name is 4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidene-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrimidine-5-carboxamide.
| Compound Name | 4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidene-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 54564555 |
| Molecular Formula | C20H16F3N3O4S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 4-hydroxy-1,3-dimethyl-6-oxo-2-sulfanylidene-N-[4-[4-(trifluoromethyl)phenoxy]phenyl]pyrimidine-5-carboxamide |
| SMILES | Cn1c(O)c(C(=O)Nc2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)c(=O)n(C)c1=S |
| InChI | InChI=1S/C20H16F3N3O4S/c1-25-17(28)15(18(29)26(2)19(25)31)16(27)24-12-5-9-14(10-6-12)30-13-7-3-11(4-8-13)20(21,22)23/h3-10,28H,1-2H3,(H,24,27) |
| InChIKey | ZSXCTSLSAWRBNP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|