C19H20O3 — CID 54564674
[(2R,4R)-2-benzyl-2,4-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone (PubChem CID 54564674) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is [(2R,4R)-2-benzyl-2,4-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone.
| Compound Name | [(2R,4R)-2-benzyl-2,4-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 54564674 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [(2R,4R)-2-benzyl-2,4-dimethyl-1,3-dioxolan-4-yl]-phenylmethanone |
| SMILES | C[C@@]1(Cc2ccccc2)OC[C@](C)(C(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H20O3/c1-18(17(20)16-11-7-4-8-12-16)14-21-19(2,22-18)13-15-9-5-3-6-10-15/h3-12H,13-14H2,1-2H3/t18-,19-/m1/s1 |
| InChIKey | ZSZCGJZMJIJCSP-RTBURBONSA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |