C12H20F6O — CID 54564720
1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)nonane (PubChem CID 54564720) has the molecular formula C12H20F6O and a molecular weight of 294.28 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)nonane.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)nonane |
|---|---|
| PubChem CID | 54564720 |
| Molecular Formula | C12H20F6O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)nonane |
| SMILES | CCCCCCCCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20F6O/c1-2-3-4-5-6-7-8-9-19-10(11(13,14)15)12(16,17)18/h10H,2-9H2,1H3 |
| InChIKey | OGJCMGZGNNKDGS-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|