About [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate
[2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate (PubChem CID 54564940) has the molecular formula C8H12N4O3
and a molecular weight of 212.21 g/mol. Its IUPAC name is [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate.
Molecular Properties
| Compound Name | [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate |
| PubChem CID | 54564940 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)C(N=O)n1cncn1 |
| InChI | InChI=1S/C8H12N4O3/c1-6(13)15-8(2,3)7(11-14)12-5-9-4-10-12/h4-5,7H,1-3H3 |
| InChIKey | ZTDGAOZEXXIWLZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 86.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate?
The IUPAC name of [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate (CID 54564940) is [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate.
What is the SMILES notation for [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate?
The canonical SMILES for [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate is CC(=O)OC(C)(C)C(N=O)n1cncn1.
What is the InChIKey of [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate?
The InChIKey is ZTDGAOZEXXIWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O3/c1-6(13)15-8(2,3)7(11-14)12-5-9-4-10-12/h4-5,7H,1-3H3.
What are the key properties of [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate?
[2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate has a molecular weight of 212.21 g/mol, XLogP of 0.88, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-1-nitroso-1-(1,2,4-triazol-1-yl)propan-2-yl] acetate is sourced from PubChem (CID 54564940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).