About (2-chloro-6-nitrophenyl) butane-1-sulfonate
(2-chloro-6-nitrophenyl) butane-1-sulfonate (PubChem CID 54565215) has the molecular formula C10H12ClNO5S
and a molecular weight of 293.73 g/mol. Its IUPAC name is (2-chloro-6-nitrophenyl) butane-1-sulfonate.
Molecular Properties
| Compound Name | (2-chloro-6-nitrophenyl) butane-1-sulfonate |
| PubChem CID | 54565215 |
| Molecular Formula | C10H12ClNO5S |
| Molecular Weight | 293.73 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | (2-chloro-6-nitrophenyl) butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)Oc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H12ClNO5S/c1-2-3-7-18(15,16)17-10-8(11)5-4-6-9(10)12(13)14/h4-6H,2-3,7H2,1H3 |
| InChIKey | ZTIHEDFJUGVLHH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-6-nitrophenyl) butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-6-nitrophenyl) butane-1-sulfonate?
The IUPAC name of (2-chloro-6-nitrophenyl) butane-1-sulfonate (CID 54565215) is (2-chloro-6-nitrophenyl) butane-1-sulfonate.
What is the SMILES notation for (2-chloro-6-nitrophenyl) butane-1-sulfonate?
The canonical SMILES for (2-chloro-6-nitrophenyl) butane-1-sulfonate is CCCCS(=O)(=O)Oc1c(Cl)cccc1[N+](=O)[O-].
What is the InChIKey of (2-chloro-6-nitrophenyl) butane-1-sulfonate?
The InChIKey is ZTIHEDFJUGVLHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClNO5S/c1-2-3-7-18(15,16)17-10-8(11)5-4-6-9(10)12(13)14/h4-6H,2-3,7H2,1H3.
What are the key properties of (2-chloro-6-nitrophenyl) butane-1-sulfonate?
(2-chloro-6-nitrophenyl) butane-1-sulfonate has a molecular weight of 293.73 g/mol, XLogP of 2.76, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-6-nitrophenyl) butane-1-sulfonate is sourced from PubChem (CID 54565215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).