C12H19Cl2N5O — CID 54565461
4,6-dichloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine (PubChem CID 54565461) has the molecular formula C12H19Cl2N5O and a molecular weight of 320.22 g/mol. Its IUPAC name is 4,6-dichloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 54565461 |
| Molecular Formula | C12H19Cl2N5O |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4,6-dichloro-N-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazin-2-amine |
| SMILES | CC1(C)CC(Nc2nc(Cl)nc(Cl)n2)CC(C)(C)N1O |
| InChI | InChI=1S/C12H19Cl2N5O/c1-11(2)5-7(6-12(3,4)19(11)20)15-10-17-8(13)16-9(14)18-10/h7,20H,5-6H2,1-4H3,(H,15,16,17,18) |
| InChIKey | ZSKOMNYGBRICDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |