C34H40N2O2 — CID 54565773
2-cycloheptyl-2-[4-[(2,3-dimethylindol-1-yl)methyl]phenyl]-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide (PubChem CID 54565773) has the molecular formula C34H40N2O2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 2-cycloheptyl-2-[4-[(2,3-dimethylindol-1-yl)methyl]phenyl]-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide.
| Compound Name | 2-cycloheptyl-2-[4-[(2,3-dimethylindol-1-yl)methyl]phenyl]-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 54565773 |
| Molecular Formula | C34H40N2O2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.31 |
| IUPAC Name | 2-cycloheptyl-2-[4-[(2,3-dimethylindol-1-yl)methyl]phenyl]-N-[(1R)-2-hydroxy-1-phenylethyl]acetamide |
| SMILES | Cc1c(C)n(Cc2ccc(C(C(=O)N[C@@H](CO)c3ccccc3)C3CCCCCC3)cc2)c2ccccc12 |
| InChI | InChI=1S/C34H40N2O2/c1-24-25(2)36(32-17-11-10-16-30(24)32)22-26-18-20-29(21-19-26)33(28-14-6-3-4-7-15-28)34(38)35-31(23-37)27-12-8-5-9-13-27/h5,8-13,16-21,28,31,33,37H,3-4,6-7,14-15,22-23H2,1-2H3,(H,35,38)/t31-,33?/m0/s1 |
| InChIKey | ZTSAFFKMTYMGRT-MOJIJOCKSA-N |
| XLogP | 7.21 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|